ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71523-79-0 N~2~-(3,4-dichlorophenyl)-N~4~-{3-[(diethylamino)methyl]-4-methoxyphenyl}-6-methylpyrimidine-2,4-diamine |
|
| 상품명칭 | N~2~-(3,4-dichlorophenyl)-N~4~-{3-[(diethylamino)methyl]-4-methoxyphenyl}-6-methylpyrimidine-2,4-diamine |
| 영문 이름 | N~2~-(3,4-dichlorophenyl)-N~4~-{3-[(diethylamino)methyl]-4-methoxyphenyl}-6-methylpyrimidine-2,4-diamine; |
| 분자식 | C23H27Cl2N5O |
| 분자량 | 460.3994 |
| InChI | InChI=1/C23H27Cl2N5O/c1-5-30(6-2)14-16-12-17(8-10-21(16)31-4)27-22-11-15(3)26-23(29-22)28-18-7-9-19(24)20(25)13-18/h7-13H,5-6,14H2,1-4H3,(H2,26,27,28,29) |
| cas번호 | 71523-79-0 |
| 분자 구조 | ![]() |
| 밀도 | 1.272g/cm3 |
| 비등점 | 588.5°C at 760 mmHg |
| 굴절 지수 | 1.635 |
| 인화점 | 309.7°C |
| 증기압 | 7.88E-14mmHg at 25°C |
| MSDS | |