ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-04-3 Pyrithyldione |
|
상품명칭 | Pyrithyldione |
영문 이름 | Pyrithyldione;3,3-Diethyl-2,4(1H,3H)-pyridinedione;3,3-diethylpyridine-2,4(1H,3H)-dione |
분자식 | C9H13NO2 |
분자량 | 167.205 |
InChI | InChI=1/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h5-6H,3-4H2,1-2H3,(H,10,12) |
cas번호 | 77-04-3 |
EC번호 | 201-000-5 |
분자 구조 | ![]() |
밀도 | 1.029g/cm3 |
비등점 | 330.2°C at 760 mmHg |
굴절 지수 | 1.464 |
인화점 | 147.8°C |
증기압 | 0.000169mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R20/21##Harmful by inhalation and in contact with skin.:; |
보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.:; |
MSDS |