ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
815-57-6 3-methylpentane-2,4-dione |
|
| 상품명칭 | 3-methylpentane-2,4-dione |
| 영문 이름 | 3-methylpentane-2,4-dione;3-Methyl-2,4-pentanedione;Methylacetylacetone;NSC 15756;2,4-Pentanedione, 3-methyl- (8CI)(9CI);3-Methylpentane-2,4-dione;(3Z)-4-hydroxy-3-methylpent-3-en-2-one |
| 분자식 | C6H10O2 |
| 분자량 | 114.1424 |
| InChI | InChI=1/C6H10O2/c1-4(5(2)7)6(3)8/h7H,1-3H3/b5-4- |
| cas번호 | 815-57-6 |
| EC번호 | 212-420-3 |
| 분자 구조 | ![]() |
| 밀도 | 0.988g/cm3 |
| 비등점 | 204.3°C at 760 mmHg |
| 굴절 지수 | 1.452 |
| 인화점 | 80.4°C |
| 증기압 | 0.0638mmHg at 25°C |
| MSDS | |