ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
298-51-1 2-(디에틸아미노)에틸 10H-페노티아진-10-카르복실레이트 하이드로클로라이드 (1:1) |
|
| 상품명칭 | 2-(디에틸아미노)에틸 10H-페노티아진-10-카르복실레이트 하이드로클로라이드 (1:1) |
| 별명 | ; 10H-페노티아진-10-카르복실산, 2-(디에틸아미노)에틸 에스테르, 모노하이드로클로라이드; 10H-페노티아진-10-카르복실산, 2-(디에틸아미노)에틸 에스테르, 염산염(1:1); 10H-페노티아진-10-카르복실산, 2-(디에틸아미노)에틸 에스테르, 모노하이드로클로라이드(9CI); 10-페노티아진카르복실산, .beta.-(디에틸아미노)에틸 에스테르 염산염; 2-(디에틸아미노)에틸 10H-페노티아진-10-카르복실레이트 염산염(1:1); 페노티아진-10-카르복실산, 2-(디에틸아미노)에틸 에스테르, 모노하이드로클로라이드(8CI); |
| 영문 이름 | 2-(diethylamino)ethyl 10H-phenothiazine-10-carboxylate hydrochloride (1:1);10H-Phenothiazine-10-carboxylic acid, 2- (diethylamino)ethyl ester, monohydrochloride;10H-phenothiazine-10-carboxylic acid, 2-(diethylamino)ethyl ester, hydrochloride (1:1);10H-Phenothiazine-10-carboxylic acid, 2-(diethylamino)ethyl ester, monohydrochloride (9CI);10-Phenothiazinecarboxylic acid, .beta.-(diethylamino)ethyl ester hydrochloride;2-(Diethylamino)ethyl 10H-phenothiazine-10-carboxylate hydrochloride (1:1);Phenothiazine-10-carboxylic acid, 2-(diethylamino)ethyl ester, monohydrochloride (8CI) |
| 분자식 | C19H23ClN2O2S |
| 분자량 | 378.9161 |
| InChI | InChI=1/C19H22N2O2S.ClH/c1-3-20(4-2)13-14-23-19(22)21-15-9-5-7-11-17(15)24-18-12-8-6-10-16(18)21;/h5-12H,3-4,13-14H2,1-2H3;1H |
| cas번호 | 298-51-1;82-00-8 |
| 분자 구조 | ![]() |
| 비등점 | 469.3°C at 760 mmHg |
| 인화점 | 237.6°C |
| 증기압 | 5.57E-09mmHg at 25°C |
| MSDS | |