ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
|
| 상품명칭 | 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
| 영문 이름 | 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde;1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl-;NSC 68230;2,5-Dimethyl-1-phenyl-1H-pyrrole-3-carbaldehyde;Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl- (8CI);1-cyclohexyl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde;2,5-dimethyl-1-phenylpyrrole-3-carbaldehyde |
| 분자식 | C13H19NO |
| 분자량 | 205.2961 |
| InChI | InChI=1/C13H19NO/c1-10-8-12(9-15)11(2)14(10)13-6-4-3-5-7-13/h8-9,13H,3-7H2,1-2H3 |
| cas번호 | 83-18-1 |
| EC번호 | 201-458-6 |
| 분자 구조 | ![]() |
| 밀도 | 1.07g/cm3 |
| 비등점 | 345.8°C at 760 mmHg |
| 굴절 지수 | 1.559 |
| 인화점 | 163°C |
| 증기압 | 6E-05mmHg at 25°C |
| 보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |