Chemindex > 83-24-9
KR ▼
83-24-9 2,5-Dimethyl-1-phenylpyrrole |
|
| 상품명칭 | 2,5-Dimethyl-1-phenylpyrrole |
| 영문 이름 | 2,5-Dimethyl-1-phenylpyrrole;1H-Pyrrole, 2,5-dimethyl-1-phenyl-;NSC 163170;2,5-Dimethyl-1-phenyl-1H-pyrrole;Pyrrole, 2,5-dimethyl-1-phenyl- (8CI);1-cyclohexyl-2,5-dimethyl-1H-pyrrole;2,5-dimethyl-1-phenylpyrrolidine |
| 분자식 | C12H17N |
| 분자량 | 175.2701 |
| InChI | InChI=1/C12H17N/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
| cas번호 | 83-24-9 |
| EC번호 | 201-461-2 |
| 분자 구조 |  |
| 밀도 | 0.952g/cm3 |
| 녹는 점 | 50-51℃ |
| 비등점 | 257.7°C at 760 mmHg |
| 굴절 지수 | 1.519 |
| 인화점 | 100.2°C |
| 증기압 | 0.0143mmHg at 25°C |
| 보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 