ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-31-4 2-amino-6-mercaptopurin-9-ylriboside |
|
| 상품명칭 | 2-amino-6-mercaptopurin-9-ylriboside |
| 영문 이름 | 2-amino-6-mercaptopurin-9-ylriboside;6-Thioguanosine |
| 분자식 | C10H12N5O4S |
| 분자량 | 298.2989 |
| InChI | InChI=1/C10H13N5O4S/c11-10-13-7-4(8(20)14-10)12-2-15(7)9-6(18)5(17)3(1-16)19-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,20)/p-1/t3-,5-,6-,9-/m1/s1 |
| cas번호 | 85-31-4 |
| EC번호 | 201-597-2 |
| 분자 구조 | ![]() |
| 비등점 | 758.6°C at 760 mmHg |
| 인화점 | 412.6°C |
| 증기압 | 3.44E-24mmHg at 25°C |
| MSDS | |