ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-88-4 ANTU |
|
| 상품명칭 | ANTU |
| 영문 이름 | ANTU;α-naphthyl thiourea;1-naphthalen-1-ylthiourea |
| 분자식 | C11H10N2S |
| 분자량 | 202.2755 |
| InChI | InChI=1/C11H10N2S/c12-11(14)13-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H3,12,13,14) |
| cas번호 | 86-88-4 |
| EC번호 | 201-706-3 |
| 분자 구조 | ![]() |
| 밀도 | 1.333g/cm3 |
| 비등점 | 377.6°C at 760 mmHg |
| 굴절 지수 | 1.794 |
| 인화점 | 182.1°C |
| 증기압 | 6.69E-06mmHg at 25°C |
| MSDS | |