ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
886498-51-7 4-Fluoro-2-methoxybenzyl bromide |
|
| 상품명칭 | 4-Fluoro-2-methoxybenzyl bromide |
| 영문 이름 | 4-Fluoro-2-methoxybenzyl bromide;1-(Bromomethyl)-4-fluoro-2-methoxybenzene;2-(Bromomethyl)-5-fluorophenyl methyl ether;benzene, 1-(bromomethyl)-4-fluoro-2-methoxy- |
| 분자식 | C8H8BrFO |
| 분자량 | 219.0509 |
| InChI | InChI=1/C8H8BrFO/c1-11-8-4-7(10)3-2-6(8)5-9/h2-4H,5H2,1H3 |
| cas번호 | 886498-51-7 |
| 분자 구조 | ![]() |
| 밀도 | 1.488g/cm3 |
| 비등점 | 220.4°C at 760 mmHg |
| 굴절 지수 | 1.531 |
| 인화점 | 105.3°C |
| 증기압 | 0.168mmHg at 25°C |
| MSDS | |