ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94159-19-0 세바신산, 1,3,5-트리아진-2,4,6-트리아민(1:2)과 화합물 |
|
상품명칭 | 세바신산, 1,3,5-트리아진-2,4,6-트리아민(1:2)과 화합물 |
별명 | 세바신산, 1,3,5-트리아진-2,4,6-트리아민(1:2)과 화합물; 데칸디오산; 1,3,5-트리아진-2,4,6-트리아민; |
영문 이름 | sebacic acid, compound with 1,3,5-triazine-2,4,6-triamine (1:2);Sebacic acid, compound with 1,3,5-triazine-2,4,6-triamine (1:2);decanedioic acid; 1,3,5-triazine-2,4,6-triamine |
분자식 | C16H30N12O4 |
분자량 | 454.4874 |
InChI | InChI=1/C10H18O4.2C3H6N6/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;2*4-1-7-2(5)9-3(6)8-1/h1-8H2,(H,11,12)(H,13,14);2*(H6,4,5,6,7,8,9) |
cas번호 | 94159-19-0 |
EC번호 | 303-195-3 |
분자 구조 | ![]() |
비등점 | 964.3°C at 760 mmHg |
인화점 | 537°C |
증기압 | 0mmHg at 25°C |
MSDS |