ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
96-86-6 Diethyl benzamidomalonate |
|
| 상품명칭 | Diethyl benzamidomalonate |
| 영문 이름 | Diethyl benzamidomalonate;Benzamidomalonic acid diethyl ester;diethyl (benzoylamino)propanedioate;diethyl (phenylcarbamoyl)propanedioate |
| 분자식 | C14H17NO5 |
| 분자량 | 279.2885 |
| InChI | InChI=1/C14H17NO5/c1-3-19-13(17)11(14(18)20-4-2)12(16)15-10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3,(H,15,16) |
| cas번호 | 96-86-6;16798-45-1 |
| EC번호 | 202-540-4 |
| 분자 구조 | ![]() |
| 밀도 | 1.22g/cm3 |
| 비등점 | 445.8°C at 760 mmHg |
| 굴절 지수 | 1.54 |
| 인화점 | 223.4°C |
| 증기압 | 3.82E-08mmHg at 25°C |
| 보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |