ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105-31-7 1-Hexyn-3-ol |
|
| Nama produk | 1-Hexyn-3-ol |
| Nama Inggeris | 1-Hexyn-3-ol;Ethynyl n-propyl carbinol;hex-1-yn-3-ol;(3S)-hex-1-yn-3-ol;(3R)-hex-1-yn-3-ol |
| MF | C6H10O |
| Berat Molekul | 98.143 |
| InChI | InChI=1/C6H10O/c1-3-5-6(7)4-2/h2,6-7H,3,5H2,1H3/t6-/m0/s1 |
| CAS NO | 105-31-7 |
| EINECS | 203-286-7 |
| Struktur Molekul | ![]() |
| Kepadatan | 0.898g/cm3 |
| Titik didih | 140.3°C at 760 mmHg |
| Indeks bias | 1.446 |
| Titik nyala | 42.7°C |
| Tekanan wap | 2.54mmHg at 25°C |
| Kod Risiko | R10##Flammable.||R25##Toxic if swallowed.||R27##Very toxic in contact with skin.:; |
| Keselamatan Penerangan | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |