ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
139669-95-7 2,4-Dibromo-thiazole-5-carbaldehyde |
|
Nama produk | 2,4-Dibromo-thiazole-5-carbaldehyde |
Nama Inggeris | 2,4-Dibromo-thiazole-5-carbaldehyde;2,4-dibromo-1,3-thiazole-5-carbaldehyde |
MF | C4HBr2NOS |
Berat Molekul | 270.9298 |
InChI | InChI=1/C4HBr2NOS/c5-3-2(1-8)9-4(6)7-3/h1H |
CAS NO | 139669-95-7 |
Struktur Molekul | ![]() |
Kepadatan | 2.332g/cm3 |
Titik lebur | 99.8℃ |
Titik didih | 317°C at 760 mmHg |
Indeks bias | 1.699 |
Titik nyala | 145.5°C |
Tekanan wap | 0.000396mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |