ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-90-3 3-(2-chloro-6-fluorophenyl)-N-(2-chloro-3-pyridinyl)-5-methyl-4-isoxazolecarboxamide |
|
Nama produk | 3-(2-chloro-6-fluorophenyl)-N-(2-chloro-3-pyridinyl)-5-methyl-4-isoxazolecarboxamide |
Sinonim | Asid 4-fluorobenzenesulfonic; 3-(2-chloro-6-fluorophenyl)-N-(2-chloropyridin-3-yl)-5-methylisoxazole-4-carboxamide; |
Nama Inggeris | 3-(2-chloro-6-fluorophenyl)-N-(2-chloro-3-pyridinyl)-5-methyl-4-isoxazolecarboxamide;4-fluorobenzenesulfonic acid;3-(2-chloro-6-fluorophenyl)-N-(2-chloropyridin-3-yl)-5-methylisoxazole-4-carboxamide |
MF | C16H10Cl2FN3O2 |
Berat Molekul | 366.1739 |
InChI | InChI=1/C16H10Cl2FN3O2/c1-8-12(16(23)21-11-6-3-7-20-15(11)18)14(22-24-8)13-9(17)4-2-5-10(13)19/h2-7H,1H3,(H,21,23) |
CAS NO | 368869-90-3 |
EINECS | 206-714-0 |
Struktur Molekul | ![]() |
Kepadatan | 1.481g/cm3 |
Titik didih | 449.8°C at 760 mmHg |
Indeks bias | 1.634 |
Titik nyala | 225.8°C |
Tekanan wap | 2.78E-08mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |