ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4693-91-8 4-methoxyphenylacetyl chloride |
|
Nama produk | 4-methoxyphenylacetyl chloride |
Nama Inggeris | 4-methoxyphenylacetyl chloride;Benzenacetyl chloride, 4-methoxy-;(p-Methoxyphenyl)acetyl chloride;(4-Methoxyphenyl)acetylchloride |
MF | C9H9ClO2 |
Berat Molekul | 184.6196 |
InChI | InChI=1/C9H9ClO2/c1-12-8-4-2-7(3-5-8)6-9(10)11/h2-5H,6H2,1H3 |
CAS NO | 4693-91-8 |
Struktur Molekul | ![]() |
Kepadatan | 1.192g/cm3 |
Titik didih | 280.1°C at 760 mmHg |
Indeks bias | 1.524 |
Titik nyala | 100°C |
Tekanan wap | 0.00387mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R34##Causes burns.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |