ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
490028-22-3 metil (3S,4S,5S,6S)-3,4,5-triacetoxy-6-[3-acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenoxy]tetrahydropyran-2-carboxylate |
|
| Nama produk | metil (3S,4S,5S,6S)-3,4,5-triacetoxy-6-[3-acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenoxy]tetrahydropyran-2-carboxylate |
| Nama Inggeris | methyl (3S,4S,5S,6S)-3,4,5-triacetoxy-6-[3-acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenoxy]tetrahydropyran-2-carboxylate; |
| MF | C31H32O14 |
| Berat Molekul | 628.5774 |
| InChI | InChI=1/C31H32O14/c1-16(32)39-23-11-9-21(10-12-23)7-8-22-13-24(40-17(2)33)15-25(14-22)44-31-29(43-20(5)36)27(42-19(4)35)26(41-18(3)34)28(45-31)30(37)38-6/h7-15,26-29,31H,1-6H3/b8-7+/t26-,27-,28?,29-,31+/m0/s1 |
| CAS NO | 490028-22-3 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.356g/cm3 |
| Titik didih | 694.817°C at 760 mmHg |
| Indeks bias | 1.569 |
| Titik nyala | 287.788°C |
| Tekanan wap | 0mmHg at 25°C |
| MSDS | |