ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
504-40-5 1,3-distearin (C18:0) | 
    |
| Nama produk | 1,3-distearin (C18:0) | 
| Nama Inggeris | 1,3-distearin (C18:0);1,3-Dioctadecanoylglycerol;1,3-Di-O-stearoylglycerol;1,3-Distearin glyceride;1,3-Distearoylglycerin;Glycerin 1,3-distearate;Glyceryl 1,3-distearate;NSC 404229;Stearic acid diglycerin ester;2-Hydroxypropane-1,3-diyl distearate;Octadecanoic acid, 2-hydroxy-1,3-propanediyl ester;Stearin, 1,3-di-;distearin (C18:0);Glyceryl distearate;Octadecanoic acid, diester with 1,2,3-propanetriol;AI3-03511;UNII-73071MW2KM;Distearic acid, diester with glycerol;2-hydroxypropane-1,3-diyl dioctadecanoate;3-hydroxypropane-1,2-diyl dioctadecanoate;Glyceryl Mono-and Distearate | 
| MF | C39H76O5 | 
| Berat Molekul | 625.02 | 
| InChI | InChI=1/C39H76O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-35-37(40)36-44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h37,40H,3-36H2,1-2H3 | 
| CAS NO | 504-40-5;1323-83-7 | 
| Struktur Molekul | ![]()  | 
    
| Kepadatan | 0.923g/cm3 | 
| Titik didih | 662.3°C at 760 mmHg | 
| Indeks bias | 1.466 | 
| Titik nyala | 181.8°C | 
| Tekanan wap | 2.33E-20mmHg at 25°C | 
| MSDS | |