ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51449-86-6 5-(2-Methylphenyl)-1H-tetrazole |
|
| Nama produk | 5-(2-Methylphenyl)-1H-tetrazole |
| Nama Inggeris | 5-(2-Methylphenyl)-1H-tetrazole;5-(o-Tolyl)-1H-tetrazole;5-(2-methylphenyl)-2H-tetrazole;5-(2-methylphenyl)tetrazol-1-ide |
| MF | C8H7N4 |
| Berat Molekul | 159.1685 |
| InChI | InChI=1/C8H7N4/c1-6-4-2-3-5-7(6)8-9-11-12-10-8/h2-5H,1H3/q-1 |
| CAS NO | 51449-86-6 |
| Struktur Molekul | ![]() |
| Titik didih | 343°C at 760 mmHg |
| Titik nyala | 164.4°C |
| Tekanan wap | 7.24E-05mmHg at 25°C |
| Kod Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |