ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
73621-21-3 1,5-diethenyl-3-methyl-2-methylidenecyclohexane |
|
| Nama produk | 1,5-diethenyl-3-methyl-2-methylidenecyclohexane |
| Sinonim | ; 1-Metil-2-metilena-3,5-divinylcyclohexane; sikloheksana, 1,5-diethenyl-3-methyl-2-methylene-; |
| Nama Inggeris | 1,5-diethenyl-3-methyl-2-methylidenecyclohexane;1-Methyl-2-methylene-3,5-divinylcyclohexane;cyclohexane, 1,5-diethenyl-3-methyl-2-methylene- |
| MF | C12H18 |
| Berat Molekul | 162.2713 |
| InChI | InChI=1/C12H18/c1-5-11-7-9(3)10(4)12(6-2)8-11/h5-6,9,11-12H,1-2,4,7-8H2,3H3 |
| CAS NO | 73621-21-3 |
| Struktur Molekul | ![]() |
| Kepadatan | 0.82g/cm3 |
| Titik didih | 192.7°C at 760 mmHg |
| Indeks bias | 1.469 |
| Titik nyala | 59.7°C |
| Tekanan wap | 0.671mmHg at 25°C |
| MSDS | |