ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
801992-71-2 4-(aminometil)-3-methoxy-anilin |
|
| Nama produk | 4-(aminometil)-3-methoxy-anilin |
| Nama Inggeris | 4-(aminomethyl)-3-methoxy-aniline; |
| MF | C8H12N2O |
| Berat Molekul | 152.19368 |
| InChI | InChI=1/C8H12N2O/c1-11-8-4-7(10)3-2-6(8)5-9/h2-4H,5,9-10H2,1H3 |
| CAS NO | 801992-71-2 |
| Struktur Molekul | ![]() |
| MSDS | |