ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-02-6 prochlorperazine dimaleate |
|
| Nama produk | prochlorperazine dimaleate |
| Nama Inggeris | prochlorperazine dimaleate;Prochlorperazine Maleate;2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]-10H-phenothiazine di[(2Z)-but-2-enedioate];but-2-enedioic acid; 2-chloro-10-[3-(4-methylpiperazin-1-yl)propyl]phenothiazine |
| MF | C28H32ClN3O8S |
| Berat Molekul | 606.087 |
| InChI | InChI=1/C20H24ClN3S.2C4H4O4/c1-22-11-13-23(14-12-22)9-4-10-24-17-5-2-3-6-19(17)25-20-8-7-16(21)15-18(20)24;2*5-3(6)1-2-4(7)8/h2-3,5-8,15H,4,9-14H2,1H3;2*1-2H,(H,5,6)(H,7,8) |
| CAS NO | 84-02-6 |
| EINECS | 201-511-3 |
| Struktur Molekul | ![]() |
| Titik didih | 864.6°C at 760 mmHg |
| Titik nyala | 476.7°C |
| Tekanan wap | 6.76E-32mmHg at 25°C |
| MSDS | |