ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-39-2 bicyclo[2.2.1]hept-5-ene-2,3-dimethanol |
|
| Nama produk | bicyclo[2.2.1]hept-5-ene-2,3-dimethanol |
| Sinonim | Bicyclo(2.2.1)hept-5-ene-2,3-dimethanol; AI3-26535 |
| Nama Inggeris | bicyclo[2.2.1]hept-5-ene-2,3-dimethanol;Bicyclo(2.2.1)hept-5-ene-2,3-dimethanol;AI3-26535 |
| MF | C9H14O2 |
| Berat Molekul | 154.208 |
| InChI | InChI=1/C9H14O2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,6-11H,3-5H2 |
| CAS NO | 85-39-2 |
| EINECS | 201-601-2 |
| Struktur Molekul | ![]() |
| MSDS | |