ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85391-01-1 3',6'-dibutoxyspiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-satu |
|
| Nama produk | 3',6'-dibutoxyspiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-satu |
| Sinonim | 3',6'-Dibutoxyspiro(isobenzofuran-1(3H),9'-(9H)xanthene)-3-satu; 3',6'-dibutoxyspiro[isobenzofuran-3,9'-xanthene]-1-satu; |
| Nama Inggeris | 3',6'-dibutoxyspiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one;3',6'-Dibutoxyspiro(isobenzofuran-1(3H),9'-(9H)xanthene)-3-one;3',6'-dibutoxyspiro[isobenzofuran-3,9'-xanthene]-1-one |
| MF | C28H28O5 |
| Berat Molekul | 444.5189 |
| InChI | InChI=1/C28H28O5/c1-3-5-15-30-19-11-13-23-25(17-19)32-26-18-20(31-16-6-4-2)12-14-24(26)28(23)22-10-8-7-9-21(22)27(29)33-28/h7-14,17-18H,3-6,15-16H2,1-2H3 |
| CAS NO | 85391-01-1 |
| EINECS | 286-753-8 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.25g/cm3 |
| Titik didih | 608.5°C at 760 mmHg |
| Indeks bias | 1.626 |
| Titik nyala | 260.8°C |
| Tekanan wap | 9.49E-15mmHg at 25°C |
| MSDS | |