ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-52-2 1-(Chloromethyl)naphthalene |
|
| Nama produk | 1-(Chloromethyl)naphthalene |
| Nama Inggeris | 1-(Chloromethyl)naphthalene;1-Naphthylmethyl chloride;1-(CHLOROMETHYL)-NAPHTHALENE;1-CMN;a-Naphthylmethyl Chloride;1-Chloromethyl naphthalene;1-Chloromethyl-naphthalene;1-Menaphthyl chloride;alpha-chloromethyl-naphthalen;1-Chloromethylnaphthalene: |
| MF | C11H9Cl |
| Berat Molekul | 176.6422 |
| InChI | InChI=1/C11H9Cl/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2 |
| CAS NO | 86-52-2 |
| EINECS | 201-678-2 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.167g/cm3 |
| Titik lebur | 20-22℃ |
| Titik didih | 291.5°C at 760 mmHg |
| Indeks bias | 1.63 |
| Titik nyala | 129.9°C |
| Tekanan wap | 0.00339mmHg at 25°C |
| Cinta bahaya | |
| Kod Risiko | R21/22||R36/37/38:; |
| Keselamatan Penerangan | S26||S36/37/39:; |
| MSDS | |