ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
97403-78-6 6-(isononanoylamino)asid hexanoic, kompaun dengan N,N-dimethylpropylamine (1:1) |
|
Nama produk | 6-(isononanoylamino)asid hexanoic, kompaun dengan N,N-dimethylpropylamine (1:1) |
Sinonim | 6-(Isononanoylamino)asid hexanoic, kompaun dengan N,N-dimethylpropylamine (1:1) |
Nama Inggeris | 6-(isononanoylamino)hexanoic acid, compound with N,N-dimethylpropylamine (1:1);6-(Isononanoylamino)hexanoic acid, compound with N,N-dimethylpropylamine (1:1) |
MF | C15H29NO3·C5H13N |
Berat Molekul | 358.5628 |
InChI | InChI=1/C15H29NO3.C5H13N/c1-13(2)9-5-3-6-10-14(17)16-12-8-4-7-11-15(18)19;1-4-5-6(2)3/h13H,3-12H2,1-2H3,(H,16,17)(H,18,19);4-5H2,1-3H3 |
CAS NO | 97403-78-6 |
EINECS | 306-740-3 |
Struktur Molekul | ![]() |
MSDS |