ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101492-19-7 3-fenoxybenzyl (2E)-4-chloor-2-(4-ethoxyfenyl)-3-fluorbut-2-enoaat |
|
| Naam product | 3-fenoxybenzyl (2E)-4-chloor-2-(4-ethoxyfenyl)-3-fluorbut-2-enoaat |
| Engelse naam | 3-phenoxybenzyl (2E)-4-chloro-2-(4-ethoxyphenyl)-3-fluorobut-2-enoate; |
| MF | C25H22ClFO4 |
| Molecuulgewicht | 440.8912 |
| InChI | InChI=1/C25H22ClFO4/c1-2-29-20-13-11-19(12-14-20)24(23(27)16-26)25(28)30-17-18-7-6-10-22(15-18)31-21-8-4-3-5-9-21/h3-15H,2,16-17H2,1H3/b24-23+ |
| CAS-nummer | 101492-19-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.229g/cm3 |
| Kookpunt | 572.3°C at 760 mmHg |
| Brekingsindex | 1.577 |
| Vlampunt | 198.2°C |
| Dampdruk | 4.18E-13mmHg at 25°C |
| MSDS | |