ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
101492-23-3 3-fenoxybenzyl (1R,2R)-2-chloor-1-(4-ethoxyfenyl)cyclopropaancarboxylaat |
|
| Naam product | 3-fenoxybenzyl (1R,2R)-2-chloor-1-(4-ethoxyfenyl)cyclopropaancarboxylaat |
| Engelse naam | 3-phenoxybenzyl (1R,2R)-2-chloro-1-(4-ethoxyphenyl)cyclopropanecarboxylate; |
| MF | C25H23ClO4 |
| Molecuulgewicht | 422.9007 |
| InChI | InChI=1/C25H23ClO4/c1-2-28-20-13-11-19(12-14-20)25(16-23(25)26)24(27)29-17-18-7-6-10-22(15-18)30-21-8-4-3-5-9-21/h3-15,23H,2,16-17H2,1H3/t23-,25+/m1/s1 |
| CAS-nummer | 101492-23-3 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.27g/cm3 |
| Kookpunt | 547.9°C at 760 mmHg |
| Brekingsindex | 1.621 |
| Vlampunt | 186.8°C |
| Dampdruk | 4.65E-12mmHg at 25°C |
| MSDS | |