ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102719-84-6 3-oxo-11-methoxytabersonine |
|
| Naam product | 3-oxo-11-methoxytabersonine |
| Synoniemen | 3-oxo-11-methoxytabersonine; Aspidospermidine-3-carbonzuur, 2,3,6,7-tetradehydro-16-methoxy-8-oxo-, methylester, (5alfa,12beta,19alfa)-; methyl (5alfa,19alfa)-16-methoxy-8-oxo-2,3,6,7-tetradehydroaspidospermidine-3-carboxylaat; |
| Engelse naam | 3-oxo-11-methoxytabersonine;3-Oxo-11-methoxytabersonine;Aspidospermidine-3-carboxylic acid, 2,3,6,7-tetradehydro-16-methoxy-8-oxo-, methyl ester, (5alpha,12beta,19alpha)-;methyl (5alpha,19alpha)-16-methoxy-8-oxo-2,3,6,7-tetradehydroaspidospermidine-3-carboxylate |
| MF | C22H24N2O4 |
| Molecuulgewicht | 380.437 |
| InChI | InChI=1/C22H24N2O4/c1-4-21-8-7-17(25)24-10-9-22(20(21)24)15-6-5-13(27-2)11-16(15)23-18(22)14(12-21)19(26)28-3/h5-8,11,20,23H,4,9-10,12H2,1-3H3/t20-,21-,22?/m0/s1 |
| CAS-nummer | 102719-84-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.34g/cm3 |
| Kookpunt | 582.8°C at 760 mmHg |
| Brekingsindex | 1.649 |
| Vlampunt | 306.3°C |
| Dampdruk | 1.43E-13mmHg at 25°C |
| MSDS | |