ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105138-47-4 3-prop-2-en-1-yl-7-thiofen-2-yl-1,2,3,4,4a,5-hexahydropyrazino[1,2-a][1,4]benzodiazepinedihydrochloride |
|
| Naam product | 3-prop-2-en-1-yl-7-thiofen-2-yl-1,2,3,4,4a,5-hexahydropyrazino[1,2-a][1,4]benzodiazepinedihydrochloride |
| Synoniemen | ;P yrazino(1,2-a)(1,4)benzodiazepine, 1,2,3,4,4a,5-hexahydro-3-(2-propenyl)-7-(2-thienyl)-, dihydrochloride; |
| Engelse naam | 3-prop-2-en-1-yl-7-thiophen-2-yl-1,2,3,4,4a,5-hexahydropyrazino[1,2-a][1,4]benzodiazepine dihydrochloride;Pyrazino(1,2-a)(1,4)benzodiazepine, 1,2,3,4,4a,5-hexahydro-3-(2-propenyl)-7-(2-thienyl)-, dihydrochloride |
| MF | C19H23Cl2N3S |
| Molecuulgewicht | 396.377 |
| InChI | InChI=1/C19H21N3S.2ClH/c1-2-9-21-10-11-22-15(14-21)13-20-19(18-8-5-12-23-18)16-6-3-4-7-17(16)22;;/h2-8,12,15H,1,9-11,13-14H2;2*1H |
| CAS-nummer | 105138-47-4 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 449.1°C at 760 mmHg |
| Vlampunt | 225.4°C |
| Dampdruk | 2.93E-08mmHg at 25°C |
| MSDS | |