ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105310-25-6 (1R,2S)-N,N-diethyl-2-[(glycylamino)methyl]-1-fenylcyclopropaancarboxamide |
|
| Naam product | (1R,2S)-N,N-diethyl-2-[(glycylamino)methyl]-1-fenylcyclopropaancarboxamide |
| Engelse naam | (1R,2S)-N,N-diethyl-2-[(glycylamino)methyl]-1-phenylcyclopropanecarboxamide; |
| MF | C17H25N3O2 |
| Molecuulgewicht | 303.3993 |
| InChI | InChI=1/C17H25N3O2/c1-3-20(4-2)16(22)17(13-8-6-5-7-9-13)10-14(17)12-19-15(21)11-18/h5-9,14H,3-4,10-12,18H2,1-2H3,(H,19,21)/t14-,17+/m1/s1 |
| CAS-nummer | 105310-25-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.133g/cm3 |
| Kookpunt | 527.4°C at 760 mmHg |
| Brekingsindex | 1.556 |
| Vlampunt | 272.7°C |
| Dampdruk | 3.28E-11mmHg at 25°C |
| MSDS | |