ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
105734-79-0 3-isocyanato-5-methyl-1,2-benzothiazol |
|
| Naam product | 3-isocyanato-5-methyl-1,2-benzothiazol |
| Engelse naam | 3-isocyanato-5-methyl-1,2-benzothiazole; |
| MF | C9H6N2OS |
| Molecuulgewicht | 190.2217 |
| InChI | InChI=1/C9H6N2OS/c1-6-2-3-8-7(4-6)9(10-5-12)11-13-8/h2-4H,1H3 |
| CAS-nummer | 105734-79-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.35g/cm3 |
| Kookpunt | 222.5°C at 760 mmHg |
| Brekingsindex | 1.685 |
| Vlampunt | 88.4°C |
| Dampdruk | 0.101mmHg at 25°C |
| MSDS | |