ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112473-92-4 3-fenoxybenzyl 2-(2-ethoxyethyl)-3-methylbutanoaat |
|
| Naam product | 3-fenoxybenzyl 2-(2-ethoxyethyl)-3-methylbutanoaat |
| Engelse naam | 3-phenoxybenzyl 2-(2-ethoxyethyl)-3-methylbutanoate; |
| MF | C22H28O4 |
| Molecuulgewicht | 356.4553 |
| InChI | InChI=1/C22H28O4/c1-4-24-14-13-21(17(2)3)22(23)25-16-18-9-8-12-20(15-18)26-19-10-6-5-7-11-19/h5-12,15,17,21H,4,13-14,16H2,1-3H3 |
| CAS-nummer | 112473-92-4 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.062g/cm3 |
| Kookpunt | 455°C at 760 mmHg |
| Brekingsindex | 1.524 |
| Vlampunt | 195.6°C |
| Dampdruk | 1.81E-08mmHg at 25°C |
| MSDS | |