ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
126584-46-1 N,N-dimethylpiperidin-3-amine dihydrochloride |
|
| Naam product | N,N-dimethylpiperidin-3-amine dihydrochloride |
| Engelse naam | N,N-dimethylpiperidin-3-amine dihydrochloride; |
| MF | C7H18Cl2N2 |
| Molecuulgewicht | 201.1372 |
| InChI | InChI=1/C7H16N2.2ClH/c1-9(2)7-4-3-5-8-6-7;;/h7-8H,3-6H2,1-2H3;2*1H |
| CAS-nummer | 126584-46-1 |
| Moleculaire Structuur | ![]() |
| Kookpunt | 259.7°C at 760 mmHg |
| Vlampunt | 110.9°C |
| Dampdruk | 0.01mmHg at 25°C |
| MSDS | |