ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
146074-42-2 3-hydroxynaphthalen-1-yl methylcarbamate |
|
| Naam product | 3-hydroxynaphthalen-1-yl methylcarbamate |
| Engelse naam | 3-hydroxynaphthalen-1-yl methylcarbamate; |
| MF | C12H11NO3 |
| Molecuulgewicht | 217.2206 |
| InChI | InChI=1/C12H11NO3/c1-13-12(15)16-11-7-9(14)6-8-4-2-3-5-10(8)11/h2-7,14H,1H3,(H,13,15) |
| CAS-nummer | 146074-42-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.289g/cm3 |
| Kookpunt | 398.6°C at 760 mmHg |
| Brekingsindex | 1.643 |
| Vlampunt | 194.9°C |
| Dampdruk | 6.33E-07mmHg at 25°C |
| MSDS | |