ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1630-94-0 1,1-dimethylcyclopropaan |
|
| Naam product | 1,1-dimethylcyclopropaan |
| Synoniemen | 1,1-dimethylcyclopropaan; cyclopropaan, 1,1-dimethyl-; |
| Engelse naam | 1,1-dimethylcyclopropane;1,1-Dimethylcyclopropane;cyclopropane, 1,1-dimethyl- |
| MF | C5H10 |
| Molecuulgewicht | 70.1329 |
| InChI | InChI=1/C5H10/c1-5(2)3-4-5/h3-4H2,1-2H3 |
| CAS-nummer | 1630-94-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 0.765g/cm3 |
| Kookpunt | 20.6°C at 760 mmHg |
| Brekingsindex | 1.419 |
| Dampdruk | 888mmHg at 25°C |
| MSDS | |