ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207986-22-9 2,3,6-trifluorobenzamide |
|
| Naam product | 2,3,6-trifluorobenzamide |
| Engelse naam | 2,3,6-trifluorobenzamide; |
| MF | C7H4F3NO |
| Molecuulgewicht | 175.108 |
| InChI | InChI=1/C7H4F3NO/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H2,11,12) |
| CAS-nummer | 207986-22-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.45g/cm3 |
| Kookpunt | 152.1°C at 760 mmHg |
| Brekingsindex | 1.494 |
| Vlampunt | 45.8°C |
| Dampdruk | 3.55mmHg at 25°C |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |