ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
21778-29-0 laurinezuur, verbinding met morfoline (1:1) |
|
Naam product | laurinezuur, verbinding met morfoline (1:1) |
Synoniemen | Dodecaanzuur, compd.with morfoline (1:1); Laurinezuur, verbinding met morfoline (1:1); dodecaanzuur - morfoline (1:1); |
Engelse naam | lauric acid, compound with morpholine (1:1);Dodecanoic acid, compd. with morpholine (1:1);Lauric acid, compound with morpholine (1:1);dodecanoic acid - morpholine (1:1) |
MF | C16H33NO3 |
Molecuulgewicht | 287.4381 |
InChI | InChI=1/C12H24O2.C4H9NO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;1-3-6-4-2-5-1/h2-11H2,1H3,(H,13,14);5H,1-4H2 |
CAS-nummer | 21778-29-0 |
EINECS | 244-576-3 |
Moleculaire Structuur | ![]() |
Kookpunt | 296.1°C at 760 mmHg |
Vlampunt | 134.1°C |
Dampdruk | 0.000661mmHg at 25°C |
MSDS |