ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
218144-79-7 3-(3-nitrofenyl)-5-(2-thienyl)-1,2,4-oxadiazol |
|
| Naam product | 3-(3-nitrofenyl)-5-(2-thienyl)-1,2,4-oxadiazol |
| Synoniemen | 3-(3-NITROFENYL)-5-(2-THIENYL)-1,2,4-OXADIAZOL; 3-(3-nitrofenyl)-5-(thiofeen-2-yl)-1,2,4-oxadiazol; |
| Engelse naam | 3-(3-nitrophenyl)-5-(2-thienyl)-1,2,4-oxadiazole;3-(3-NITROPHENYL)-5-(2-THIENYL)-1,2,4-OXADIAZOLE;3-(3-nitrophenyl)-5-(thiophen-2-yl)-1,2,4-oxadiazole |
| MF | C12H7N3O3S |
| Molecuulgewicht | 273.2673 |
| InChI | InChI=1/C12H7N3O3S/c16-15(17)9-4-1-3-8(7-9)11-13-12(18-14-11)10-5-2-6-19-10/h1-7H |
| CAS-nummer | 218144-79-7 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.433g/cm3 |
| Smeltpunt | 160℃ |
| Kookpunt | 466.2°C at 760 mmHg |
| Brekingsindex | 1.642 |
| Vlampunt | 235.7°C |
| Dampdruk | 2.02E-08mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |