ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
220461-83-6 4-(1H-pyrazol-1-yl)benzoyl chloride |
|
| Naam product | 4-(1H-pyrazol-1-yl)benzoyl chloride |
| Engelse naam | 4-(1H-pyrazol-1-yl)benzoyl chloride;4-pyrazol-1-ylbenzoyl chloride |
| MF | C10H7ClN2O |
| Molecuulgewicht | 206.6284 |
| InChI | InChI=1/C10H7ClN2O/c11-10(14)8-2-4-9(5-3-8)13-7-1-6-12-13/h1-7H |
| CAS-nummer | 220461-83-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.303g/cm3 |
| Smeltpunt | 118℃ |
| Kookpunt | 319.861°C at 760 mmHg |
| Brekingsindex | 1.624 |
| Vlampunt | 147.247°C |
| Dampdruk | 0mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R34##Causes burns.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |