ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2444-68-0 9-Vinylanthracene |
|
Naam product | 9-Vinylanthracene |
Engelse naam | 9-Vinylanthracene;9-Ethenylanthracen;Anthracene, 9-ethenyl- (9CI);9-ethenylanthracene |
MF | C16H12 |
Molecuulgewicht | 204.2665 |
InChI | InChI=1/C16H12/c1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14/h2-11H,1H2 |
CAS-nummer | 2444-68-0 |
EINECS | 219-486-2 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.112g/cm3 |
Smeltpunt | 64-66℃ |
Kookpunt | 377°C at 760 mmHg |
Brekingsindex | 1.724 |
Vlampunt | 172.4°C |
Dampdruk | 1.51E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |