ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25198-48-5 [2-(4-chloorfenyl)ethyl]hydrazine |
|
| Naam product | [2-(4-chloorfenyl)ethyl]hydrazine |
| Synoniemen | ; Hydrazine, (2-(4-chloorfenyl)ethyl)-; |
| Engelse naam | [2-(4-chlorophenyl)ethyl]hydrazine;Hydrazine, (2-(4-chlorophenyl)ethyl)- |
| MF | C8H11ClN2 |
| Molecuulgewicht | 170.6393 |
| InChI | InChI=1/C8H11ClN2/c9-8-3-1-7(2-4-8)5-6-11-10/h1-4,11H,5-6,10H2 |
| CAS-nummer | 25198-48-5;2598-25-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.163g/cm3 |
| Kookpunt | 314.9°C at 760 mmHg |
| Brekingsindex | 1.565 |
| Vlampunt | 144.3°C |
| Dampdruk | 0.000452mmHg at 25°C |
| MSDS | |