ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
263016-18-8 ethyl-4-hydroxy-2-(4-methylfenyl)-1,3-thiazool-5-carboxylaat |
|
Naam product | ethyl-4-hydroxy-2-(4-methylfenyl)-1,3-thiazool-5-carboxylaat |
Engelse naam | ethyl 4-hydroxy-2-(4-methylphenyl)-1,3-thiazole-5-carboxylate; |
MF | C13H13NO3S |
Molecuulgewicht | 263.3122 |
InChI | InChI=1/C13H13NO3S/c1-3-17-13(16)10-11(15)14-12(18-10)9-6-4-8(2)5-7-9/h4-7,15H,3H2,1-2H3 |
CAS-nummer | 263016-18-8 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.274g/cm3 |
Smeltpunt | 128℃ |
Kookpunt | 399.4°C at 760 mmHg |
Brekingsindex | 1.597 |
Vlampunt | 195.4°C |
Dampdruk | 5.95E-07mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |