ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27018-14-0 5-methylquinazoline-2,4-diamine |
|
| Naam product | 5-methylquinazoline-2,4-diamine |
| Engelse naam | 5-methylquinazoline-2,4-diamine; |
| MF | C9H10N4 |
| Molecuulgewicht | 174.2025 |
| InChI | InChI=1/C9H10N4/c1-5-3-2-4-6-7(5)8(10)13-9(11)12-6/h2-4H,1H3,(H4,10,11,12,13) |
| CAS-nummer | 27018-14-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.331g/cm3 |
| Kookpunt | 461.2°C at 760 mmHg |
| Brekingsindex | 1.755 |
| Vlampunt | 263.7°C |
| Dampdruk | 1.09E-08mmHg at 25°C |
| MSDS | |