ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29456-03-9 5-(bromomethyl)-2-methyl-1H-isoindole-1,3(2H)-dione |
|
| Naam product | 5-(bromomethyl)-2-methyl-1H-isoindole-1,3(2H)-dione |
| Engelse naam | 5-(bromomethyl)-2-methyl-1H-isoindole-1,3(2H)-dione; |
| MF | C10H8BrNO2 |
| Molecuulgewicht | 254.08 |
| InChI | InChI=1/C10H8BrNO2/c1-12-9(13)7-3-2-6(5-11)4-8(7)10(12)14/h2-4H,5H2,1H3 |
| CAS-nummer | 29456-03-9 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.67g/cm3 |
| Kookpunt | 362.4°C at 760 mmHg |
| Brekingsindex | 1.643 |
| Vlampunt | 173°C |
| Dampdruk | 1.94E-05mmHg at 25°C |
| MSDS | |