ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
298690-85-4 2-Thiophen-3-yl-pyrrolidine |
|
| Naam product | 2-Thiophen-3-yl-pyrrolidine |
| Engelse naam | 2-Thiophen-3-yl-pyrrolidine;2-(3-Thienyl)pyrrolidine;2-(thiophen-3-yl)pyrrolidine;pyrrolidine, 2-(3-thienyl)-;2-Thiophen-3-Ylpyrrolidine |
| MF | C8H11NS |
| Molecuulgewicht | 153.2446 |
| InChI | InChI=1/C8H11NS/c1-2-8(9-4-1)7-3-5-10-6-7/h3,5-6,8-9H,1-2,4H2 |
| CAS-nummer | 298690-85-4 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.107g/cm3 |
| Kookpunt | 245°C at 760 mmHg |
| Brekingsindex | 1.557 |
| Vlampunt | 102°C |
| Dampdruk | 0.0294mmHg at 25°C |
| MSDS | |