ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
303098-84-2 4-[(2,5-dimethylfenyl)carbonyl]fenylacetaat |
|
| Naam product | 4-[(2,5-dimethylfenyl)carbonyl]fenylacetaat |
| Engelse naam | 4-[(2,5-dimethylphenyl)carbonyl]phenyl acetate; |
| MF | C17H16O3 |
| Molecuulgewicht | 268.3071 |
| InChI | InChI=1/C17H16O3/c1-11-4-5-12(2)16(10-11)17(19)14-6-8-15(9-7-14)20-13(3)18/h4-10H,1-3H3 |
| CAS-nummer | 303098-84-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.128g/cm3 |
| Kookpunt | 393°C at 760 mmHg |
| Brekingsindex | 1.561 |
| Vlampunt | 172.8°C |
| Dampdruk | 2.19E-06mmHg at 25°C |
| MSDS | |