ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
304675-72-7 4-nitroguaiacol, kaliumzouthydraat |
|
| Naam product | 4-nitroguaiacol, kaliumzouthydraat |
| Synoniemen | 4-Nitroguaiacol kaliumzout hydraat; kalium-2-methoxy-4-nitrofenolaathydraat; |
| Engelse naam | 4-nitroguaiacol, potassium salt hydrate;4-Nitroguaiacol potassium salt hydrate;potassium 2-methoxy-4-nitrophenolate hydrate |
| MF | C7H8KNO5 |
| Molecuulgewicht | 225.2404 |
| InChI | InChI=1/C7H7NO4.K.H2O/c1-12-7-4-5(8(10)11)2-3-6(7)9;;/h2-4,9H,1H3;;1H2/q;+1;/p-1 |
| CAS-nummer | 304675-72-7 |
| Moleculaire Structuur | ![]() |
| Smeltpunt | 300℃ |
| MSDS | |