ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306934-81-6 4-amino-5-nitro-2-spirocyclohexyl-2H-benzimidazool-1-oxide |
|
| Naam product | 4-amino-5-nitro-2-spirocyclohexyl-2H-benzimidazool-1-oxide |
| Synoniemen | 5-nitrospiro[benzimidazool-2,1'-cyclohexaan]-4-amine 1-oxide; |
| Engelse naam | 4-amino-5-nitro-2-spirocyclohexyl-2H-benzimidazole-1-oxide;5-nitrospiro[benzimidazole-2,1'-cyclohexan]-4-amine 1-oxide |
| MF | C12H14N4O3 |
| Molecuulgewicht | 262.2646 |
| InChI | InChI=1/C12H14N4O3/c13-10-8(16(18)19)4-5-9-11(10)14-12(15(9)17)6-2-1-3-7-12/h4-5H,1-3,6-7,13H2 |
| CAS-nummer | 306934-81-6 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.63g/cm3 |
| Kookpunt | 416.6°C at 760 mmHg |
| Brekingsindex | 1.761 |
| Vlampunt | 205.7°C |
| Dampdruk | 3.78E-07mmHg at 25°C |
| MSDS | |