ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-58-0 2,2-dimethyl-5-nitro-2H-benzimidazooltrihydraat |
|
Naam product | 2,2-dimethyl-5-nitro-2H-benzimidazooltrihydraat |
Engelse naam | 2,2-dimethyl-5-nitro-2H-benzimidazole trihydrate; |
MF | C9H15N3O5 |
Molecuulgewicht | 245.2325 |
InChI | InChI=1/C9H9N3O2.3H2O/c1-9(2)10-7-4-3-6(12(13)14)5-8(7)11-9;;;/h3-5H,1-2H3;3*1H2 |
CAS-nummer | 306935-58-0 |
Moleculaire Structuur | ![]() |
Smeltpunt | 239℃ |
Kookpunt | 259.3°C at 760 mmHg |
Vlampunt | 110.6°C |
Dampdruk | 0.0211mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |