ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306936-93-6 5-(3,4-dichloorbenzyl)-1,3,4-oxadiazol-2-thiol |
|
Naam product | 5-(3,4-dichloorbenzyl)-1,3,4-oxadiazol-2-thiol |
Synoniemen | 5-(3,4-dichloorbenzyl)-1,3,4-oxadiazol-2(3H)-thion; |
Engelse naam | 5-(3,4-dichlorobenzyl)-1,3,4-oxadiazole-2-thiol;5-(3,4-dichlorobenzyl)-1,3,4-oxadiazole-2(3H)-thione |
MF | C9H6Cl2N2OS |
Molecuulgewicht | 261.1277 |
InChI | InChI=1/C9H6Cl2N2OS/c10-6-2-1-5(3-7(6)11)4-8-12-13-9(15)14-8/h1-3H,4H2,(H,13,15) |
CAS-nummer | 306936-93-6 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.59g/cm3 |
Smeltpunt | 141℃ |
Kookpunt | 343°C at 760 mmHg |
Brekingsindex | 1.695 |
Vlampunt | 161.2°C |
Dampdruk | 7.25E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |