ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 306936-93-6 5-(3,4-dichloorbenzyl)-1,3,4-oxadiazol-2-thiol | |
| Naam product | 5-(3,4-dichloorbenzyl)-1,3,4-oxadiazol-2-thiol | 
| Synoniemen | 5-(3,4-dichloorbenzyl)-1,3,4-oxadiazol-2(3H)-thion; | 
| Engelse naam | 5-(3,4-dichlorobenzyl)-1,3,4-oxadiazole-2-thiol;5-(3,4-dichlorobenzyl)-1,3,4-oxadiazole-2(3H)-thione | 
| MF | C9H6Cl2N2OS | 
| Molecuulgewicht | 261.1277 | 
| InChI | InChI=1/C9H6Cl2N2OS/c10-6-2-1-5(3-7(6)11)4-8-12-13-9(15)14-8/h1-3H,4H2,(H,13,15) | 
| CAS-nummer | 306936-93-6 | 
| Moleculaire Structuur |  | 
| Dichtheid | 1.59g/cm3 | 
| Smeltpunt | 141℃ | 
| Kookpunt | 343°C at 760 mmHg | 
| Brekingsindex | 1.695 | 
| Vlampunt | 161.2°C | 
| Dampdruk | 7.25E-05mmHg at 25°C | 
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |